C6H9NO6S2 — CID 90416093
1-methyl-1-sulfo-2H-pyridin-1-ium-4-sulfonate (PubChem CID 90416093) has the molecular formula C6H9NO6S2 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-methyl-1-sulfo-2H-pyridin-1-ium-4-sulfonate.
| Compound Name | 1-methyl-1-sulfo-2H-pyridin-1-ium-4-sulfonate |
|---|---|
| PubChem CID | 90416093 |
| Molecular Formula | C6H9NO6S2 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 1-methyl-1-sulfo-2H-pyridin-1-ium-4-sulfonate |
| SMILES | C[N+]1(S(=O)(=O)O)C=CC(S(=O)(=O)[O-])=CC1 |
| InChI | InChI=1S/C6H9NO6S2/c1-7(15(11,12)13)4-2-6(3-5-7)14(8,9)10/h2-4H,5H2,1H3,(H-,8,9,10,11,12,13) |
| InChIKey | WMSPKGXSGRFXMI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|