C28H36O5 — CID 90416130
2,5-dimethylhex-3-yne-2,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate (PubChem CID 90416130) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is 2,5-dimethylhex-3-yne-2,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate.
| Compound Name | 2,5-dimethylhex-3-yne-2,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate |
|---|---|
| PubChem CID | 90416130 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2,5-dimethylhex-3-yne-2,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate |
| SMILES | CC(C)(O)C#CC(C)(C)O.Cc1cc(C)c(OC(=O)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H22O3.C8H14O2/c1-11-7-13(3)17(14(4)8-11)18(21)20(22)23-19-15(5)9-12(2)10-16(19)6;1-7(2,9)5-6-8(3,4)10/h7-10H,1-6H3;9-10H,1-4H3 |
| InChIKey | HRKABMXASAZDHF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|