C11H14N2S — CID 904164
N-phenyl-4,5,6,7-tetrahydro-1,3-thiazepin-2-amine (PubChem CID 904164) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is N-phenyl-4,5,6,7-tetrahydro-1,3-thiazepin-2-amine.
| Compound Name | N-phenyl-4,5,6,7-tetrahydro-1,3-thiazepin-2-amine |
|---|---|
| PubChem CID | 904164 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-phenyl-4,5,6,7-tetrahydro-1,3-thiazepin-2-amine |
| SMILES | c1ccc(NC2=NCCCCS2)cc1 |
| InChI | InChI=1S/C11H14N2S/c1-2-6-10(7-3-1)13-11-12-8-4-5-9-14-11/h1-3,6-7H,4-5,8-9H2,(H,12,13) |
| InChIKey | ZRLLGZXMGFLFHR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |