C21H21F2N3O4 — CID 90416612
3-[2-(4,4-difluorocyclohexyl)oxy-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridine (PubChem CID 90416612) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is 3-[2-(4,4-difluorocyclohexyl)oxy-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridine.
| Compound Name | 3-[2-(4,4-difluorocyclohexyl)oxy-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 90416612 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 3-[2-(4,4-difluorocyclohexyl)oxy-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridine |
| SMILES | COc1nccc2c(-c3cc([N+](=O)[O-])ccc3OC3CCC(F)(F)CC3)cn(C)c12 |
| InChI | InChI=1S/C21H21F2N3O4/c1-25-12-17(15-7-10-24-20(29-2)19(15)25)16-11-13(26(27)28)3-4-18(16)30-14-5-8-21(22,23)9-6-14/h3-4,7,10-12,14H,5-6,8-9H2,1-2H3 |
| InChIKey | PLQYYQNRONGNQM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|