C14H14O6 — CID 90416964
2-[2-(2,4,6-trihydroxyphenyl)ethyl]benzene-1,3,5-triol (PubChem CID 90416964) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[2-(2,4,6-trihydroxyphenyl)ethyl]benzene-1,3,5-triol.
| Compound Name | 2-[2-(2,4,6-trihydroxyphenyl)ethyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 90416964 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[2-(2,4,6-trihydroxyphenyl)ethyl]benzene-1,3,5-triol |
| SMILES | Oc1cc(O)c(CCc2c(O)cc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C14H14O6/c15-7-3-11(17)9(12(18)4-7)1-2-10-13(19)5-8(16)6-14(10)20/h3-6,15-20H,1-2H2 |
| InChIKey | WDMKDLXXAZKZTF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |