About 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide
4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide (PubChem CID 90417363) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide |
| PubChem CID | 90417363 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide |
| SMILES | CCC[C@H](NC(=O)C(C)(C)C)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-5-6-13(17-15(20)16(2,3)4)11-7-9-12(10-8-11)14(19)18-21/h7-10,13,21H,5-6H2,1-4H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | KXNGGPOKYCWSRV-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide (CID 90417363) is 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide is CCC[C@H](NC(=O)C(C)(C)C)c1ccc(C(=O)NO)cc1.
What is the InChIKey of 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide?
The InChIKey is KXNGGPOKYCWSRV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-5-6-13(17-15(20)16(2,3)4)11-7-9-12(10-8-11)14(19)18-21/h7-10,13,21H,5-6H2,1-4H3,(H,17,20)(H,18,19)/t13-/m0/s1.
What are the key properties of 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide?
4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide has a molecular weight of 292.38 g/mol, XLogP of 2.81, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1-(2,2-dimethylpropanoylamino)butyl]-N-hydroxybenzamide is sourced from PubChem (CID 90417363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).