C25H28F3O6P — CID 90417487
benzoic acid;diphenylphosphinic acid;1,1,1-trifluoro-3-methylpentane-2,4-diol (PubChem CID 90417487) has the molecular formula C25H28F3O6P and a molecular weight of 512.46 g/mol. Its IUPAC name is benzoic acid;diphenylphosphinic acid;1,1,1-trifluoro-3-methylpentane-2,4-diol.
| Compound Name | benzoic acid;diphenylphosphinic acid;1,1,1-trifluoro-3-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 90417487 |
| Molecular Formula | C25H28F3O6P |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | benzoic acid;diphenylphosphinic acid;1,1,1-trifluoro-3-methylpentane-2,4-diol |
| SMILES | CC(O)C(C)C(O)C(F)(F)F.O=C(O)c1ccccc1.O=P(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11O2P.C7H6O2.C6H11F3O2/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6;1-3(4(2)10)5(11)6(7,8)9/h1-10H,(H,13,14);1-5H,(H,8,9);3-5,10-11H,1-2H3 |
| InChIKey | LUBLPNODUMKIFF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|