About tert-butyl-chloro-dimethylsilane;ethoxyethane
tert-butyl-chloro-dimethylsilane;ethoxyethane (PubChem CID 90417785) has the molecular formula C10H25ClOSi
and a molecular weight of 224.85 g/mol. Its IUPAC name is tert-butyl-chloro-dimethylsilane;ethoxyethane.
Molecular Properties
| Compound Name | tert-butyl-chloro-dimethylsilane;ethoxyethane |
| PubChem CID | 90417785 |
| Molecular Formula | C10H25ClOSi |
| Molecular Weight | 224.85 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | tert-butyl-chloro-dimethylsilane;ethoxyethane |
| SMILES | CC(C)(C)[Si](C)(C)Cl.CCOCC |
| InChI | InChI=1S/C6H15ClSi.C4H10O/c1-6(2,3)8(4,5)7;1-3-5-4-2/h1-5H3;3-4H2,1-2H3 |
| InChIKey | ILDKIIHQNHBBAR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-chloro-dimethylsilane;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-chloro-dimethylsilane;ethoxyethane?
The IUPAC name of tert-butyl-chloro-dimethylsilane;ethoxyethane (CID 90417785) is tert-butyl-chloro-dimethylsilane;ethoxyethane.
What is the SMILES notation for tert-butyl-chloro-dimethylsilane;ethoxyethane?
The canonical SMILES for tert-butyl-chloro-dimethylsilane;ethoxyethane is CC(C)(C)[Si](C)(C)Cl.CCOCC.
What is the InChIKey of tert-butyl-chloro-dimethylsilane;ethoxyethane?
The InChIKey is ILDKIIHQNHBBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClSi.C4H10O/c1-6(2,3)8(4,5)7;1-3-5-4-2/h1-5H3;3-4H2,1-2H3.
What are the key properties of tert-butyl-chloro-dimethylsilane;ethoxyethane?
tert-butyl-chloro-dimethylsilane;ethoxyethane has a molecular weight of 224.85 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-chloro-dimethylsilane;ethoxyethane is sourced from PubChem (CID 90417785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).