About 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid
6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid (PubChem CID 90417981) has the molecular formula C14H8ClF2N3O2
and a molecular weight of 323.69 g/mol. Its IUPAC name is 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid |
| PubChem CID | 90417981 |
| Molecular Formula | C14H8ClF2N3O2 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid |
| SMILES | Nc1c(F)c(-c2cccc(C(=O)O)n2)c(F)c2[nH]cc(Cl)c12 |
| InChI | InChI=1S/C14H8ClF2N3O2/c15-5-4-19-13-8(5)12(18)10(16)9(11(13)17)6-2-1-3-7(20-6)14(21)22/h1-4,19H,18H2,(H,21,22) |
| InChIKey | FFEVQBVYLDIEJA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid (CID 90417981) is 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid is Nc1c(F)c(-c2cccc(C(=O)O)n2)c(F)c2[nH]cc(Cl)c12.
What is the InChIKey of 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid?
The InChIKey is FFEVQBVYLDIEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClF2N3O2/c15-5-4-19-13-8(5)12(18)10(16)9(11(13)17)6-2-1-3-7(20-6)14(21)22/h1-4,19H,18H2,(H,21,22).
What are the key properties of 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid?
6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid has a molecular weight of 323.69 g/mol, XLogP of 3.44, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylic acid is sourced from PubChem (CID 90417981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).