About methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate
methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate (PubChem CID 90418001) has the molecular formula C15H10ClF2N3O2
and a molecular weight of 337.71 g/mol. Its IUPAC name is methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate |
| PubChem CID | 90418001 |
| Molecular Formula | C15H10ClF2N3O2 |
| Molecular Weight | 337.71 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(-c2c(F)c(N)c3c(Cl)c[nH]c3c2F)n1 |
| InChI | InChI=1S/C15H10ClF2N3O2/c1-23-15(22)8-4-2-3-7(21-8)10-11(17)13(19)9-6(16)5-20-14(9)12(10)18/h2-5,20H,19H2,1H3 |
| InChIKey | TYBQQPRSRFKTQV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate (CID 90418001) is methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate is COC(=O)c1cccc(-c2c(F)c(N)c3c(Cl)c[nH]c3c2F)n1.
What is the InChIKey of methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate?
The InChIKey is TYBQQPRSRFKTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2N3O2/c1-23-15(22)8-4-2-3-7(21-8)10-11(17)13(19)9-6(16)5-20-14(9)12(10)18/h2-5,20H,19H2,1H3.
What are the key properties of methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate?
methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate has a molecular weight of 337.71 g/mol, XLogP of 3.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(4-amino-3-chloro-5,7-difluoro-1H-indol-6-yl)pyridine-2-carboxylate is sourced from PubChem (CID 90418001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).