C32H31F3O7 — CID 90418064
benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol (PubChem CID 90418064) has the molecular formula C32H31F3O7 and a molecular weight of 584.59 g/mol. Its IUPAC name is benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol.
| Compound Name | benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 90418064 |
| Molecular Formula | C32H31F3O7 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol |
| SMILES | Cc1cc(C)c(C(=O)C(=O)O)c(C)c1.O=C(O)c1ccccc1.OC(CC(O)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H13F3O2.C11H12O3.C7H6O2/c15-14(16,17)13(19)8-12(18)11-6-5-9-3-1-2-4-10(9)7-11;1-6-4-7(2)9(8(3)5-6)10(12)11(13)14;8-7(9)6-4-2-1-3-5-6/h1-7,12-13,18-19H,8H2;4-5H,1-3H3,(H,13,14);1-5H,(H,8,9) |
| InChIKey | IRMHTDLAZSUOLF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|