C15H14F5NO3S2 — CID 90418228
[3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methyl methanesulfonate (PubChem CID 90418228) has the molecular formula C15H14F5NO3S2 and a molecular weight of 415.41 g/mol. Its IUPAC name is [3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methyl methanesulfonate.
| Compound Name | [3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90418228 |
| Molecular Formula | C15H14F5NO3S2 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | [3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methyl methanesulfonate |
| SMILES | CCc1ccc(-c2nsc(C(F)(F)C(F)(F)F)c2COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14F5NO3S2/c1-3-9-4-6-10(7-5-9)12-11(8-24-26(2,22)23)13(25-21-12)14(16,17)15(18,19)20/h4-7H,3,8H2,1-2H3 |
| InChIKey | QRJMFUXSLHNTDK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|