About [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate
[3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate (PubChem CID 90418265) has the molecular formula C12H9ClF3NO3S2
and a molecular weight of 371.79 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate |
| PubChem CID | 90418265 |
| Molecular Formula | C12H9ClF3NO3S2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1c(-c2ccc(Cl)cc2)nsc1C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3NO3S2/c1-22(18,19)20-6-9-10(7-2-4-8(13)5-3-7)17-21-11(9)12(14,15)16/h2-5H,6H2,1H3 |
| InChIKey | IFERQEKIHKJDCM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate?
The IUPAC name of [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate (CID 90418265) is [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate.
What is the SMILES notation for [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate?
The canonical SMILES for [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate is CS(=O)(=O)OCc1c(-c2ccc(Cl)cc2)nsc1C(F)(F)F.
What is the InChIKey of [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate?
The InChIKey is IFERQEKIHKJDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3NO3S2/c1-22(18,19)20-6-9-10(7-2-4-8(13)5-3-7)17-21-11(9)12(14,15)16/h2-5H,6H2,1H3.
What are the key properties of [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate?
[3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate has a molecular weight of 371.79 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-5-(trifluoromethyl)-1,2-thiazol-4-yl]methyl methanesulfonate is sourced from PubChem (CID 90418265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).