C14H12F5NOS — CID 90418883
[3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methanol (PubChem CID 90418883) has the molecular formula C14H12F5NOS and a molecular weight of 337.31 g/mol. Its IUPAC name is [3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methanol.
| Compound Name | [3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 90418883 |
| Molecular Formula | C14H12F5NOS |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | [3-(4-ethylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazol-4-yl]methanol |
| SMILES | CCc1ccc(-c2nsc(C(F)(F)C(F)(F)F)c2CO)cc1 |
| InChI | InChI=1S/C14H12F5NOS/c1-2-8-3-5-9(6-4-8)11-10(7-21)12(22-20-11)13(15,16)14(17,18)19/h3-6,21H,2,7H2,1H3 |
| InChIKey | PYUBONNDVVSDAJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|