About 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol
1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol (PubChem CID 90418989) has the molecular formula C12H23F2NO
and a molecular weight of 235.32 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol |
| PubChem CID | 90418989 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol |
| SMILES | CC(C)(C)N1CCC(O)(CCC(F)F)CC1 |
| InChI | InChI=1S/C12H23F2NO/c1-11(2,3)15-8-6-12(16,7-9-15)5-4-10(13)14/h10,16H,4-9H2,1-3H3 |
| InChIKey | RTKFMNRQFMVDKG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol?
The IUPAC name of 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol (CID 90418989) is 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol.
What is the SMILES notation for 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol?
The canonical SMILES for 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol is CC(C)(C)N1CCC(O)(CCC(F)F)CC1.
What is the InChIKey of 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol?
The InChIKey is RTKFMNRQFMVDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2NO/c1-11(2,3)15-8-6-12(16,7-9-15)5-4-10(13)14/h10,16H,4-9H2,1-3H3.
What are the key properties of 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol?
1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol has a molecular weight of 235.32 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(3,3-difluoropropyl)piperidin-4-ol is sourced from PubChem (CID 90418989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).