About 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine
2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 90419613) has the molecular formula C22H28N4O
and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 90419613 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccncc1-c1ccnc2[nH]c(C3CCN(C(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C22H28N4O/c1-22(2,3)26-11-7-15(8-12-26)19-13-17-16(5-10-24-21(17)25-19)18-14-23-9-6-20(18)27-4/h5-6,9-10,13-15H,7-8,11-12H2,1-4H3,(H,24,25) |
| InChIKey | GGCLKRPQMFMKJB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine (CID 90419613) is 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine is COc1ccncc1-c1ccnc2[nH]c(C3CCN(C(C)(C)C)CC3)cc12.
What is the InChIKey of 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is GGCLKRPQMFMKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O/c1-22(2,3)26-11-7-15(8-12-26)19-13-17-16(5-10-24-21(17)25-19)18-14-23-9-6-20(18)27-4/h5-6,9-10,13-15H,7-8,11-12H2,1-4H3,(H,24,25).
What are the key properties of 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine?
2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 364.49 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-tert-butylpiperidin-4-yl)-4-(4-methoxy-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 90419613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).