C29H32FN3O3 — CID 90419651
2-[4-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]cyclohexyl]acetic acid (PubChem CID 90419651) has the molecular formula C29H32FN3O3 and a molecular weight of 489.59 g/mol. Its IUPAC name is 2-[4-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 90419651 |
| Molecular Formula | C29H32FN3O3 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[4-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]cyclohexyl]acetic acid |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CC4CN(C5CCC(CC(=O)O)CC5)CC4C3)cc12 |
| InChI | InChI=1S/C29H32FN3O3/c1-36-27-7-4-21(30)13-24(27)23-8-9-31-29-25(23)14-26(32-29)18-11-19-15-33(16-20(19)12-18)22-5-2-17(3-6-22)10-28(34)35/h4,7-9,11,13-14,17,19-20,22H,2-3,5-6,10,12,15-16H2,1H3,(H,31,32)(H,34,35) |
| InChIKey | YKADCEBZGUVYNP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |