C21H18FN3O3 — CID 90419885
7-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 90419885) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is 7-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | 7-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 90419885 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 7-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CC4COC(=O)N4CC3)cc12 |
| InChI | InChI=1S/C21H18FN3O3/c1-27-19-3-2-13(22)9-16(19)15-4-6-23-20-17(15)10-18(24-20)12-5-7-25-14(8-12)11-28-21(25)26/h2-4,6,8-10,14H,5,7,11H2,1H3,(H,23,24) |
| InChIKey | ZWJDMOSWRHVDGH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |