C23H19F2N5O2 — CID 90419910
N-cyano-3-[5-fluoro-4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxamide (PubChem CID 90419910) has the molecular formula C23H19F2N5O2 and a molecular weight of 435.43 g/mol. Its IUPAC name is N-cyano-3-[5-fluoro-4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxamide.
| Compound Name | N-cyano-3-[5-fluoro-4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 90419910 |
| Molecular Formula | C23H19F2N5O2 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-cyano-3-[5-fluoro-4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxamide |
| SMILES | COc1ccc(F)cc1-c1c(F)cnc2[nH]c(C3=CC4CCC(C3)N4C(=O)NC#N)cc12 |
| InChI | InChI=1S/C23H19F2N5O2/c1-32-20-5-2-13(24)8-16(20)21-17-9-19(29-22(17)27-10-18(21)25)12-6-14-3-4-15(7-12)30(14)23(31)28-11-26/h2,5-6,8-10,14-15H,3-4,7H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | KGSAMZQBYLTAOE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|