C25H27FN4O4S — CID 90419959
2-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N,N-dimethyl-2-oxoethanesulfonamide (PubChem CID 90419959) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N,N-dimethyl-2-oxoethanesulfonamide.
| Compound Name | 2-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N,N-dimethyl-2-oxoethanesulfonamide |
|---|---|
| PubChem CID | 90419959 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-[5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N,N-dimethyl-2-oxoethanesulfonamide |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CC4CN(C(=O)CS(=O)(=O)N(C)C)CC4C3)cc12 |
| InChI | InChI=1S/C25H27FN4O4S/c1-29(2)35(32,33)14-24(31)30-12-16-8-15(9-17(16)13-30)22-11-21-19(6-7-27-25(21)28-22)20-10-18(26)4-5-23(20)34-3/h4-8,10-11,16-17H,9,12-14H2,1-3H3,(H,27,28) |
| InChIKey | ZLIJEVQNXGYSCG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |