About N-(2,2-dimethylpropanoyl)sulfamoyl chloride
N-(2,2-dimethylpropanoyl)sulfamoyl chloride (PubChem CID 90420117) has the molecular formula C5H10ClNO3S
and a molecular weight of 199.66 g/mol. Its IUPAC name is N-(2,2-dimethylpropanoyl)sulfamoyl chloride.
Molecular Properties
| Compound Name | N-(2,2-dimethylpropanoyl)sulfamoyl chloride |
| PubChem CID | 90420117 |
| Molecular Formula | C5H10ClNO3S |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | N-(2,2-dimethylpropanoyl)sulfamoyl chloride |
| SMILES | CC(C)(C)C(=O)NS(=O)(=O)Cl |
| InChI | InChI=1S/C5H10ClNO3S/c1-5(2,3)4(8)7-11(6,9)10/h1-3H3,(H,7,8) |
| InChIKey | CFVAIVRFUTVKBM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-dimethylpropanoyl)sulfamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
The IUPAC name of N-(2,2-dimethylpropanoyl)sulfamoyl chloride (CID 90420117) is N-(2,2-dimethylpropanoyl)sulfamoyl chloride.
What is the SMILES notation for N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
The canonical SMILES for N-(2,2-dimethylpropanoyl)sulfamoyl chloride is CC(C)(C)C(=O)NS(=O)(=O)Cl.
What is the InChIKey of N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
The InChIKey is CFVAIVRFUTVKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO3S/c1-5(2,3)4(8)7-11(6,9)10/h1-3H3,(H,7,8).
What are the key properties of N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
N-(2,2-dimethylpropanoyl)sulfamoyl chloride has a molecular weight of 199.66 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethylpropanoyl)sulfamoyl chloride is sourced from PubChem (CID 90420117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).