N-(2,2-dimethylpropanoyl)sulfamoyl chloride

C5H10ClNO3S — CID 90420117

IUPACN-(2,2-dimethylpropanoyl)sulfamoyl chloride
SMILESCC(C)(C)C(=O)NS(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO3S/c1-5(2,3)4(8)7-11(6,9)10/h1-3H3,(H,7,8)
InChIKeyCFVAIVRFUTVKBM-UHFFFAOYSA-N
MW199.66 g/mol
LogP0.63
Rot. Bonds1

About N-(2,2-dimethylpropanoyl)sulfamoyl chloride

N-(2,2-dimethylpropanoyl)sulfamoyl chloride (PubChem CID 90420117) has the molecular formula C5H10ClNO3S and a molecular weight of 199.66 g/mol. Its IUPAC name is N-(2,2-dimethylpropanoyl)sulfamoyl chloride.

Molecular Properties

Compound NameN-(2,2-dimethylpropanoyl)sulfamoyl chloride
PubChem CID90420117
Molecular FormulaC5H10ClNO3S
Molecular Weight199.66 g/mol
Exact Mass199.01
IUPAC NameN-(2,2-dimethylpropanoyl)sulfamoyl chloride
SMILESCC(C)(C)C(=O)NS(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO3S/c1-5(2,3)4(8)7-11(6,9)10/h1-3H3,(H,7,8)
InChIKeyCFVAIVRFUTVKBM-UHFFFAOYSA-N
XLogP0.63
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.66
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-(2,2-dimethylpropanoyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
The IUPAC name of N-(2,2-dimethylpropanoyl)sulfamoyl chloride (CID 90420117) is N-(2,2-dimethylpropanoyl)sulfamoyl chloride.
What is the SMILES notation for N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
The canonical SMILES for N-(2,2-dimethylpropanoyl)sulfamoyl chloride is CC(C)(C)C(=O)NS(=O)(=O)Cl.
What is the InChIKey of N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
The InChIKey is CFVAIVRFUTVKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO3S/c1-5(2,3)4(8)7-11(6,9)10/h1-3H3,(H,7,8).
What are the key properties of N-(2,2-dimethylpropanoyl)sulfamoyl chloride?
N-(2,2-dimethylpropanoyl)sulfamoyl chloride has a molecular weight of 199.66 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethylpropanoyl)sulfamoyl chloride is sourced from PubChem (CID 90420117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).