C25H19FN4O3 — CID 90420231
4-(5-fluoro-2-methoxyphenyl)-2-[6-(4-nitrophenyl)-2,3-dihydropyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 90420231) has the molecular formula C25H19FN4O3 and a molecular weight of 442.45 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxyphenyl)-2-[6-(4-nitrophenyl)-2,3-dihydropyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(5-fluoro-2-methoxyphenyl)-2-[6-(4-nitrophenyl)-2,3-dihydropyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90420231 |
| Molecular Formula | C25H19FN4O3 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-(5-fluoro-2-methoxyphenyl)-2-[6-(4-nitrophenyl)-2,3-dihydropyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CC(c4ccc([N+](=O)[O-])cc4)=NCC3)cc12 |
| InChI | InChI=1S/C25H19FN4O3/c1-33-24-7-4-17(26)13-20(24)19-9-11-28-25-21(19)14-23(29-25)16-8-10-27-22(12-16)15-2-5-18(6-3-15)30(31)32/h2-7,9,11-14H,8,10H2,1H3,(H,28,29) |
| InChIKey | LNPVSAYTYPFBIC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|