About 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde
1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde (PubChem CID 90420463) has the molecular formula C9H15F2NO
and a molecular weight of 191.22 g/mol. Its IUPAC name is 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde |
| PubChem CID | 90420463 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde |
| SMILES | CC(C)(C)N1CC(F)(F)CC1C=O |
| InChI | InChI=1S/C9H15F2NO/c1-8(2,3)12-6-9(10,11)4-7(12)5-13/h5,7H,4,6H2,1-3H3 |
| InChIKey | MWFVSCXINAZZQJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde?
The IUPAC name of 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde (CID 90420463) is 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde.
What is the SMILES notation for 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde?
The canonical SMILES for 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde is CC(C)(C)N1CC(F)(F)CC1C=O.
What is the InChIKey of 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde?
The InChIKey is MWFVSCXINAZZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO/c1-8(2,3)12-6-9(10,11)4-7(12)5-13/h5,7H,4,6H2,1-3H3.
What are the key properties of 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde?
1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde has a molecular weight of 191.22 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4,4-difluoropyrrolidine-2-carbaldehyde is sourced from PubChem (CID 90420463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).