C13H21NO2 — CID 90420621
(2R)-4-(1,2,3,3a,4,5-hexahydropentalen-2-yl)-2-amino-3-methylbutanoic acid (PubChem CID 90420621) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (2R)-4-(1,2,3,3a,4,5-hexahydropentalen-2-yl)-2-amino-3-methylbutanoic acid.
| Compound Name | (2R)-4-(1,2,3,3a,4,5-hexahydropentalen-2-yl)-2-amino-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90420621 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (2R)-4-(1,2,3,3a,4,5-hexahydropentalen-2-yl)-2-amino-3-methylbutanoic acid |
| SMILES | CC(CC1CC2=CCCC2C1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C13H21NO2/c1-8(12(14)13(15)16)5-9-6-10-3-2-4-11(10)7-9/h3,8-9,11-12H,2,4-7,14H2,1H3,(H,15,16)/t8?,9?,11?,12-/m1/s1 |
| InChIKey | AMFGPMLMAOUIKT-HYHRHQCWSA-N |
| XLogP | 2.17 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|