C25H27FN4O4 — CID 90420719
1-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,2,3,6-tetrahydropyridin-2-yl]ethanone (PubChem CID 90420719) has the molecular formula C25H27FN4O4 and a molecular weight of 466.51 g/mol. Its IUPAC name is 1-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,2,3,6-tetrahydropyridin-2-yl]ethanone.
| Compound Name | 1-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,2,3,6-tetrahydropyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 90420719 |
| Molecular Formula | C25H27FN4O4 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 1-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1,2,3,6-tetrahydropyridin-2-yl]ethanone |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CCNC(CC(=O)N4C[C@H](O)[C@@H](O)C4)C3)cc12 |
| InChI | InChI=1S/C25H27FN4O4/c1-34-23-3-2-15(26)9-18(23)17-5-7-28-25-19(17)11-20(29-25)14-4-6-27-16(8-14)10-24(33)30-12-21(31)22(32)13-30/h2-5,7,9,11,16,21-22,27,31-32H,6,8,10,12-13H2,1H3,(H,28,29)/t16?,21-,22-/m0/s1 |
| InChIKey | HPBRPFUYHCWPQG-LALCZMHNSA-N |
| XLogP | 2.08 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |