About 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride
4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride (PubChem CID 90421309) has the molecular formula C13H13ClN4
and a molecular weight of 260.73 g/mol. Its IUPAC name is 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride |
| PubChem CID | 90421309 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride |
| SMILES | Cc1[nH]nc2cc(-c3ccc(N)cc3)ncc12.Cl |
| InChI | InChI=1S/C13H12N4.ClH/c1-8-11-7-15-12(6-13(11)17-16-8)9-2-4-10(14)5-3-9;/h2-7H,14H2,1H3,(H,16,17);1H |
| InChIKey | WOHOQHGUDCGRQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride?
The IUPAC name of 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride (CID 90421309) is 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride.
What is the SMILES notation for 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride?
The canonical SMILES for 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride is Cc1[nH]nc2cc(-c3ccc(N)cc3)ncc12.Cl.
What is the InChIKey of 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride?
The InChIKey is WOHOQHGUDCGRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4.ClH/c1-8-11-7-15-12(6-13(11)17-16-8)9-2-4-10(14)5-3-9;/h2-7H,14H2,1H3,(H,16,17);1H.
What are the key properties of 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride?
4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride has a molecular weight of 260.73 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-2H-pyrazolo[4,3-c]pyridin-6-yl)aniline;hydrochloride is sourced from PubChem (CID 90421309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).