C11H18NO6P — CID 90421590
1-[bis(2-methylprop-2-enoyl)amino]propan-2-yl dihydrogen phosphate (PubChem CID 90421590) has the molecular formula C11H18NO6P and a molecular weight of 291.24 g/mol. Its IUPAC name is 1-[bis(2-methylprop-2-enoyl)amino]propan-2-yl dihydrogen phosphate.
| Compound Name | 1-[bis(2-methylprop-2-enoyl)amino]propan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 90421590 |
| Molecular Formula | C11H18NO6P |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[bis(2-methylprop-2-enoyl)amino]propan-2-yl dihydrogen phosphate |
| SMILES | C=C(C)C(=O)N(CC(C)OP(=O)(O)O)C(=O)C(=C)C |
| InChI | InChI=1S/C11H18NO6P/c1-7(2)10(13)12(11(14)8(3)4)6-9(5)18-19(15,16)17/h9H,1,3,6H2,2,4-5H3,(H2,15,16,17) |
| InChIKey | ZSCDHRCIFVPCIP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|