About 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene
1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene (PubChem CID 90421597) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene.
Molecular Properties
| Compound Name | 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene |
| PubChem CID | 90421597 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene |
| SMILES | C=COC=C.C=COCC1(COC=C)CCCCC1 |
| InChI | InChI=1S/C12H20O2.C4H6O/c1-3-13-10-12(11-14-4-2)8-6-5-7-9-12;1-3-5-4-2/h3-4H,1-2,5-11H2;3-4H,1-2H2 |
| InChIKey | YTBWUEJOXSUMKN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene?
The IUPAC name of 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene (CID 90421597) is 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene.
What is the SMILES notation for 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene?
The canonical SMILES for 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene is C=COC=C.C=COCC1(COC=C)CCCCC1.
What is the InChIKey of 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene?
The InChIKey is YTBWUEJOXSUMKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.C4H6O/c1-3-13-10-12(11-14-4-2)8-6-5-7-9-12;1-3-5-4-2/h3-4H,1-2,5-11H2;3-4H,1-2H2.
What are the key properties of 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene?
1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene has a molecular weight of 266.38 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(ethenoxymethyl)cyclohexane;ethenoxyethene is sourced from PubChem (CID 90421597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).