C18H27BO4 — CID 90421657
4,4,5,5-tetramethyl-2-[4-[2-(oxolan-3-yl)ethoxy]phenyl]-1,3,2-dioxaborolane (PubChem CID 90421657) has the molecular formula C18H27BO4 and a molecular weight of 318.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[2-(oxolan-3-yl)ethoxy]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[2-(oxolan-3-yl)ethoxy]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90421657 |
| Molecular Formula | C18H27BO4 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[2-(oxolan-3-yl)ethoxy]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(OCCC3CCOC3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H27BO4/c1-17(2)18(3,4)23-19(22-17)15-5-7-16(8-6-15)21-12-10-14-9-11-20-13-14/h5-8,14H,9-13H2,1-4H3 |
| InChIKey | INGXUNGJMWZZCK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|