About 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride
4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride (PubChem CID 90421751) has the molecular formula C5H2Cl4N2O
and a molecular weight of 247.90 g/mol. Its IUPAC name is 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride |
| PubChem CID | 90421751 |
| Molecular Formula | C5H2Cl4N2O |
| Molecular Weight | 247.90 g/mol |
| Exact Mass | 245.89 |
| IUPAC Name | 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride |
| SMILES | Cl.O=C(Cl)c1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C5HCl3N2O.ClH/c6-3-2(5(8)11)4(7)10-1-9-3;/h1H;1H |
| InChIKey | YSUQWMZCJCEJEN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.90 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride?
The IUPAC name of 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride (CID 90421751) is 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride.
What is the SMILES notation for 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride?
The canonical SMILES for 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride is Cl.O=C(Cl)c1c(Cl)ncnc1Cl.
What is the InChIKey of 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride?
The InChIKey is YSUQWMZCJCEJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HCl3N2O.ClH/c6-3-2(5(8)11)4(7)10-1-9-3;/h1H;1H.
What are the key properties of 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride?
4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride has a molecular weight of 247.90 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloropyrimidine-5-carbonyl chloride;hydrochloride is sourced from PubChem (CID 90421751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).