About 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one
8-bromo-3,6-dimethyl-1H-quinoxalin-2-one (PubChem CID 90421767) has the molecular formula C10H9BrN2O
and a molecular weight of 253.10 g/mol. Its IUPAC name is 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one |
| PubChem CID | 90421767 |
| Molecular Formula | C10H9BrN2O |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one |
| SMILES | Cc1cc(Br)c2[nH]c(=O)c(C)nc2c1 |
| InChI | InChI=1S/C10H9BrN2O/c1-5-3-7(11)9-8(4-5)12-6(2)10(14)13-9/h3-4H,1-2H3,(H,13,14) |
| InChIKey | YTUXFCWODOVJJG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one?
The IUPAC name of 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one (CID 90421767) is 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one.
What is the SMILES notation for 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one?
The canonical SMILES for 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one is Cc1cc(Br)c2[nH]c(=O)c(C)nc2c1.
What is the InChIKey of 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one?
The InChIKey is YTUXFCWODOVJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O/c1-5-3-7(11)9-8(4-5)12-6(2)10(14)13-9/h3-4H,1-2H3,(H,13,14).
What are the key properties of 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one?
8-bromo-3,6-dimethyl-1H-quinoxalin-2-one has a molecular weight of 253.10 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3,6-dimethyl-1H-quinoxalin-2-one is sourced from PubChem (CID 90421767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).