C24H33N7O3 — CID 90421871
(2S,11S)-11-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 90421871) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2S,11S)-11-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S,11S)-11-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 90421871 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (2S,11S)-11-[[(2S,3S)-2-acetamido-3-methylpentyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CC[C@H](C)[C@@H](CN[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCc1cn[nH]n1)C3)NC(C)=O |
| InChI | InChI=1S/C24H33N7O3/c1-4-14(2)20(28-15(3)32)13-25-19-9-8-16-6-5-7-17-10-21(31(22(16)17)24(19)34)23(33)26-11-18-12-27-30-29-18/h5-7,12,14,19-21,25H,4,8-11,13H2,1-3H3,(H,26,33)(H,28,32)(H,27,29,30)/t14-,19-,20+,21-/m0/s1 |
| InChIKey | YSTJTUCDPPSJMT-VJICWTENSA-N |
| XLogP | 0.83 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |