About 7aH-furo[2,3-b]pyran
7aH-furo[2,3-b]pyran (PubChem CID 90421915) has the molecular formula C7H6O2
and a molecular weight of 122.12 g/mol. Its IUPAC name is 7aH-furo[2,3-b]pyran.
Molecular Properties
| Compound Name | 7aH-furo[2,3-b]pyran |
|---|
| PubChem CID | 90421915 |
|---|
| Molecular Formula | C7H6O2 |
|---|
| Molecular Weight | 122.12 g/mol |
|---|
| Exact Mass | 122.04 |
|---|
| IUPAC Name | 7aH-furo[2,3-b]pyran |
|---|
| SMILES | C1=COC2OC=CC2=C1 |
|---|
| InChI | InChI=1S/C7H6O2/c1-2-6-3-5-9-7(6)8-4-1/h1-5,7H |
|---|
| InChIKey | OEEUEIARTHJEHF-UHFFFAOYSA-N |
|---|
| XLogP | 1.33 |
|---|
| TPSA | 18.46 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7aH-furo[2,3-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-furo[2,3-b]pyran?
The IUPAC name of 7aH-furo[2,3-b]pyran (CID 90421915) is 7aH-furo[2,3-b]pyran.
What is the SMILES notation for 7aH-furo[2,3-b]pyran?
The canonical SMILES for 7aH-furo[2,3-b]pyran is C1=COC2OC=CC2=C1.
What is the InChIKey of 7aH-furo[2,3-b]pyran?
The InChIKey is OEEUEIARTHJEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2/c1-2-6-3-5-9-7(6)8-4-1/h1-5,7H.
What are the key properties of 7aH-furo[2,3-b]pyran?
7aH-furo[2,3-b]pyran has a molecular weight of 122.12 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-furo[2,3-b]pyran is sourced from PubChem (CID 90421915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).