C21H21Cl3N3O2S+ — CID 90422059
4-[(1S,3R)-3-(2-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-1-yl]sulfonyl-1-methylimidazole (PubChem CID 90422059) has the molecular formula C21H21Cl3N3O2S+ and a molecular weight of 485.84 g/mol. Its IUPAC name is 4-[(1S,3R)-3-(2-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-1-yl]sulfonyl-1-methylimidazole.
| Compound Name | 4-[(1S,3R)-3-(2-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-1-yl]sulfonyl-1-methylimidazole |
|---|---|
| PubChem CID | 90422059 |
| Molecular Formula | C21H21Cl3N3O2S+ |
| Molecular Weight | 485.84 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 4-[(1S,3R)-3-(2-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-1-yl]sulfonyl-1-methylimidazole |
| SMILES | Cn1cnc(S(=O)(=O)[N@@+]2(Cc3ccc(Cl)cc3Cl)CC[C@H](c3ccccc3Cl)C2)c1 |
| InChI | InChI=1S/C21H21Cl3N3O2S/c1-26-11-21(25-14-26)30(28,29)27(13-16-6-7-17(22)10-20(16)24)9-8-15(12-27)18-4-2-3-5-19(18)23/h2-7,10-11,14-15H,8-9,12-13H2,1H3/q+1/t15-,27-/m0/s1 |
| InChIKey | GFXBAMCWZUXYLH-QZXCRCNTSA-N |
| XLogP | 5.27 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.84 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|