C12H16N2 — CID 90422191
1,2,3,4,5,5a-hexahydrobenzo[g]isoindol-3a-amine (PubChem CID 90422191) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,2,3,4,5,5a-hexahydrobenzo[g]isoindol-3a-amine.
| Compound Name | 1,2,3,4,5,5a-hexahydrobenzo[g]isoindol-3a-amine |
|---|---|
| PubChem CID | 90422191 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1,2,3,4,5,5a-hexahydrobenzo[g]isoindol-3a-amine |
| SMILES | NC12CCC3C=CC=CC3=C1CNC2 |
| InChI | InChI=1S/C12H16N2/c13-12-6-5-9-3-1-2-4-10(9)11(12)7-14-8-12/h1-4,9,14H,5-8,13H2 |
| InChIKey | JWJFLDDQXQRQGN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |