About [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid
[(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid (PubChem CID 90422490) has the molecular formula C9H19NO4
and a molecular weight of 205.25 g/mol. Its IUPAC name is [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid |
| PubChem CID | 90422490 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid |
| SMILES | C[C@@H](OC(C)(C)C)[C@@H](CO)NC(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-6(14-9(2,3)4)7(5-11)10-8(12)13/h6-7,10-11H,5H2,1-4H3,(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | PMWHVOPWWSOMAN-RNFRBKRXSA-N |
| XLogP | 0.82 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid?
The IUPAC name of [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid (CID 90422490) is [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid.
What is the SMILES notation for [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid?
The canonical SMILES for [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid is C[C@@H](OC(C)(C)C)[C@@H](CO)NC(=O)O.
What is the InChIKey of [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid?
The InChIKey is PMWHVOPWWSOMAN-RNFRBKRXSA-N. The full InChI is InChI=1S/C9H19NO4/c1-6(14-9(2,3)4)7(5-11)10-8(12)13/h6-7,10-11H,5H2,1-4H3,(H,12,13)/t6-,7-/m1/s1.
What are the key properties of [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid?
[(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid has a molecular weight of 205.25 g/mol, XLogP of 0.82, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamic acid is sourced from PubChem (CID 90422490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).