C13H14N8O7S2 — CID 90422573
[(1R,7S)-7-[[(2-amino-1,3-thiazole-4-carbonyl)amino]carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 90422573) has the molecular formula C13H14N8O7S2 and a molecular weight of 458.44 g/mol. Its IUPAC name is [(1R,7S)-7-[[(2-amino-1,3-thiazole-4-carbonyl)amino]carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1R,7S)-7-[[(2-amino-1,3-thiazole-4-carbonyl)amino]carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90422573 |
| Molecular Formula | C13H14N8O7S2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | [(1R,7S)-7-[[(2-amino-1,3-thiazole-4-carbonyl)amino]carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | Cn1ncc2c1[C@@H](C(=O)NNC(=O)c1csc(N)n1)N1C[C@@H]2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H14N8O7S2/c1-19-8-5(2-15-19)7-3-20(13(24)21(7)28-30(25,26)27)9(8)11(23)18-17-10(22)6-4-29-12(14)16-6/h2,4,7,9H,3H2,1H3,(H2,14,16)(H,17,22)(H,18,23)(H,25,26,27)/t7-,9-/m0/s1 |
| InChIKey | XIUYMMVUGYKCQO-CBAPKCEASA-N |
| XLogP | -1.51 |
| TPSA | 202.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|