C14H13F2N5O7S — CID 90422878
[(1R,8S)-8-[[(2,2-difluorocyclopropanecarbonyl)amino]carbamoyl]-10-oxo-6,9,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl] hydrogen sulfate (PubChem CID 90422878) has the molecular formula C14H13F2N5O7S and a molecular weight of 433.35 g/mol. Its IUPAC name is [(1R,8S)-8-[[(2,2-difluorocyclopropanecarbonyl)amino]carbamoyl]-10-oxo-6,9,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl] hydrogen sulfate.
| Compound Name | [(1R,8S)-8-[[(2,2-difluorocyclopropanecarbonyl)amino]carbamoyl]-10-oxo-6,9,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90422878 |
| Molecular Formula | C14H13F2N5O7S |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | [(1R,8S)-8-[[(2,2-difluorocyclopropanecarbonyl)amino]carbamoyl]-10-oxo-6,9,11-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)[C@@H]1c2ncccc2[C@@H]2CN1C(=O)N2OS(=O)(=O)O)C1CC1(F)F |
| InChI | InChI=1S/C14H13F2N5O7S/c15-14(16)4-7(14)11(22)18-19-12(23)10-9-6(2-1-3-17-9)8-5-20(10)13(24)21(8)28-29(25,26)27/h1-3,7-8,10H,4-5H2,(H,18,22)(H,19,23)(H,25,26,27)/t7?,8-,10-/m0/s1 |
| InChIKey | YXMRYIJTEHLQHY-CFGJQEBVSA-N |
| XLogP | -0.55 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|