C32H45NO4 — CID 90423686
[(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-(2,3-dihydroindol-1-ylmethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-acetyloxy-2-methylcyclohexyl]methyl acetate (PubChem CID 90423686) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-(2,3-dihydroindol-1-ylmethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-acetyloxy-2-methylcyclohexyl]methyl acetate.
| Compound Name | [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-(2,3-dihydroindol-1-ylmethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-acetyloxy-2-methylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 90423686 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-(2,3-dihydroindol-1-ylmethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-acetyloxy-2-methylcyclohexyl]methyl acetate |
| SMILES | C=C1CC[C@H]2[C@H](CN3CCc4ccccc43)[C@@H]([C@@]3(C)CC[C@H](OC(C)=O)C[C@@H]3COC(C)=O)CC[C@]12C |
| InChI | InChI=1S/C32H45NO4/c1-21-10-11-28-27(19-33-17-14-24-8-6-7-9-30(24)33)29(13-16-31(21,28)4)32(5)15-12-26(37-23(3)35)18-25(32)20-36-22(2)34/h6-9,25-29H,1,10-20H2,2-5H3/t25-,26+,27+,28+,29+,31-,32+/m1/s1 |
| InChIKey | PPZPDFWJWABIEJ-NEGDUPRSSA-N |
| XLogP | 6.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|