C29H33F6N4O5P+2 — CID 90424048
(2-amino-2-oxoethyl)-carbamimidoyl-methyl-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid) (PubChem CID 90424048) has the molecular formula C29H33F6N4O5P+2 and a molecular weight of 662.57 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-carbamimidoyl-methyl-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2-amino-2-oxoethyl)-carbamimidoyl-methyl-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 90424048 |
| Molecular Formula | C29H33F6N4O5P+2 |
| Molecular Weight | 662.57 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | (2-amino-2-oxoethyl)-carbamimidoyl-methyl-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)[N+](C)(CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CC(N)=O |
| InChI | InChI=1S/C25H30N4OP.2C2HF3O2/c1-29(25(27)28,20-24(26)30)18-11-19-31(21-12-5-2-6-13-21,22-14-7-3-8-15-22)23-16-9-4-10-17-23;2*3-2(4,5)1(6)7/h2-10,12-17H,11,18-20H2,1H3,(H4-,26,27,28,30);2*(H,6,7)/q+1;;/p+1 |
| InChIKey | IXKZSNFLSKBYGK-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|