About 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid
4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid (PubChem CID 90424060) has the molecular formula C14H22F2N2O3
and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid |
| PubChem CID | 90424060 |
| Molecular Formula | C14H22F2N2O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid |
| SMILES | O=C1NC[C@@H]1N(CCCCC1CCC(F)(F)CC1)C(=O)O |
| InChI | InChI=1S/C14H22F2N2O3/c15-14(16)6-4-10(5-7-14)3-1-2-8-18(13(20)21)11-9-17-12(11)19/h10-11H,1-9H2,(H,17,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | PXAHNWGBAAASTA-NSHDSACASA-N |
| XLogP | 2.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid?
The IUPAC name of 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid (CID 90424060) is 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid.
What is the SMILES notation for 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid?
The canonical SMILES for 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid is O=C1NC[C@@H]1N(CCCCC1CCC(F)(F)CC1)C(=O)O.
What is the InChIKey of 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid?
The InChIKey is PXAHNWGBAAASTA-NSHDSACASA-N. The full InChI is InChI=1S/C14H22F2N2O3/c15-14(16)6-4-10(5-7-14)3-1-2-8-18(13(20)21)11-9-17-12(11)19/h10-11H,1-9H2,(H,17,19)(H,20,21)/t11-/m0/s1.
What are the key properties of 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid?
4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid has a molecular weight of 304.34 g/mol, XLogP of 2.46, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluorocyclohexyl)butyl-[(3S)-2-oxoazetidin-3-yl]carbamic acid is sourced from PubChem (CID 90424060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).