About (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate
(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate (PubChem CID 90424408) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate.
Molecular Properties
| Compound Name | (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate |
| PubChem CID | 90424408 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C15H24O2/c1-5-10(2)14(16)17-9-11-6-7-12-8-13(11)15(12,3)4/h6,10,12-13H,5,7-9H2,1-4H3 |
| InChIKey | NMVOOLZURJHGKQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate?
The IUPAC name of (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate (CID 90424408) is (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate.
What is the SMILES notation for (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate?
The canonical SMILES for (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate is CCC(C)C(=O)OCC1=CCC2CC1C2(C)C.
What is the InChIKey of (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate?
The InChIKey is NMVOOLZURJHGKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-5-10(2)14(16)17-9-11-6-7-12-8-13(11)15(12,3)4/h6,10,12-13H,5,7-9H2,1-4H3.
What are the key properties of (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate?
(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate has a molecular weight of 236.35 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl 2-methylbutanoate is sourced from PubChem (CID 90424408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).