About 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid
3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid (PubChem CID 90424558) has the molecular formula C16H21F2NO3
and a molecular weight of 313.34 g/mol. Its IUPAC name is 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid |
| PubChem CID | 90424558 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid |
| SMILES | CCCCc1c(C2CCC(F)(F)CC2)ccn(C(=O)O)c1=O |
| InChI | InChI=1S/C16H21F2NO3/c1-2-3-4-13-12(7-10-19(14(13)20)15(21)22)11-5-8-16(17,18)9-6-11/h7,10-11H,2-6,8-9H2,1H3,(H,21,22) |
| InChIKey | DOWAKWYYZWQFMG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid?
The IUPAC name of 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid (CID 90424558) is 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid.
What is the SMILES notation for 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid?
The canonical SMILES for 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid is CCCCc1c(C2CCC(F)(F)CC2)ccn(C(=O)O)c1=O.
What is the InChIKey of 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid?
The InChIKey is DOWAKWYYZWQFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2NO3/c1-2-3-4-13-12(7-10-19(14(13)20)15(21)22)11-5-8-16(17,18)9-6-11/h7,10-11H,2-6,8-9H2,1H3,(H,21,22).
What are the key properties of 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid?
3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid has a molecular weight of 313.34 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylic acid is sourced from PubChem (CID 90424558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).