C12H11F3N2O4S — CID 90424581
2-(1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide (PubChem CID 90424581) has the molecular formula C12H11F3N2O4S and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 90424581 |
| Molecular Formula | C12H11F3N2O4S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O4S/c13-12(14,15)7-16-22(20,21)6-5-17-10(18)8-3-1-2-4-9(8)11(17)19/h1-4,16H,5-7H2 |
| InChIKey | WJLNBNGDPKRACA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|