C30H35F6N4O5P+2 — CID 90424722
carbamimidoyl-methyl-[2-(methylamino)-2-oxoethyl]-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid) (PubChem CID 90424722) has the molecular formula C30H35F6N4O5P+2 and a molecular weight of 676.60 g/mol. Its IUPAC name is carbamimidoyl-methyl-[2-(methylamino)-2-oxoethyl]-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid).
| Compound Name | carbamimidoyl-methyl-[2-(methylamino)-2-oxoethyl]-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 90424722 |
| Molecular Formula | C30H35F6N4O5P+2 |
| Molecular Weight | 676.60 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | carbamimidoyl-methyl-[2-(methylamino)-2-oxoethyl]-(3-triphenylphosphaniumylpropyl)azanium;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)[N+](C)(CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)NC |
| InChI | InChI=1S/C26H32N4OP.2C2HF3O2/c1-29-25(31)21-30(2,26(27)28)19-12-20-32(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;2*3-2(4,5)1(6)7/h3-11,13-18H,12,19-21H2,1-2H3,(H3-,27,28,29,31);2*(H,6,7)/q+1;;/p+1 |
| InChIKey | UEBFUFMHEMJKFO-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 153.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|