C32H30ClN5O3S — CID 90424888
N-[[5-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]-3-pyridinyl]sulfonyl]-3,3-dimethylbutanamide (PubChem CID 90424888) has the molecular formula C32H30ClN5O3S and a molecular weight of 600.14 g/mol. Its IUPAC name is N-[[5-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]-3-pyridinyl]sulfonyl]-3,3-dimethylbutanamide.
| Compound Name | N-[[5-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]-3-pyridinyl]sulfonyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90424888 |
| Molecular Formula | C32H30ClN5O3S |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | N-[[5-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]-3-pyridinyl]sulfonyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NS(=O)(=O)c1cncc(-c2c(Cl)nc(NCc3ccccn3)c3c(-c4ccccc4)cccc23)c1 |
| InChI | InChI=1S/C32H30ClN5O3S/c1-32(2,3)17-27(39)38-42(40,41)24-16-22(18-34-20-24)28-26-14-9-13-25(21-10-5-4-6-11-21)29(26)31(37-30(28)33)36-19-23-12-7-8-15-35-23/h4-16,18,20H,17,19H2,1-3H3,(H,36,37)(H,38,39) |
| InChIKey | PIJGQWSTXATTFH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|