(2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid

C10H20N2O2 — CID 90425190

IUPAC(2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid
SMILESCC1(C)CCCC(C)(C)N1NC(=O)O
InChIInChI=1S/C10H20N2O2/c1-9(2)6-5-7-10(3,4)12(9)11-8(13)14/h11H,5-7H2,1-4H3,(H,13,14)
InChIKeySWYCFMWUFSJFDA-UHFFFAOYSA-N
MW200.28 g/mol
LogP2.21
Rot. Bonds1

About (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid

(2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid (PubChem CID 90425190) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid.

Molecular Properties

Compound Name(2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid
PubChem CID90425190
Molecular FormulaC10H20N2O2
Molecular Weight200.28 g/mol
Exact Mass200.15
IUPAC Name(2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid
SMILESCC1(C)CCCC(C)(C)N1NC(=O)O
InChIInChI=1S/C10H20N2O2/c1-9(2)6-5-7-10(3,4)12(9)11-8(13)14/h11H,5-7H2,1-4H3,(H,13,14)
InChIKeySWYCFMWUFSJFDA-UHFFFAOYSA-N
XLogP2.21
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid?
The IUPAC name of (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid (CID 90425190) is (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid.
What is the SMILES notation for (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid?
The canonical SMILES for (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid is CC1(C)CCCC(C)(C)N1NC(=O)O.
What is the InChIKey of (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid?
The InChIKey is SWYCFMWUFSJFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-9(2)6-5-7-10(3,4)12(9)11-8(13)14/h11H,5-7H2,1-4H3,(H,13,14).
What are the key properties of (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid?
(2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid has a molecular weight of 200.28 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,6,6-tetramethylpiperidin-1-yl)carbamic acid is sourced from PubChem (CID 90425190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).