About (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one
(3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one (PubChem CID 90425260) has the molecular formula C12H28N2OSi2
and a molecular weight of 272.54 g/mol. Its IUPAC name is (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one |
| PubChem CID | 90425260 |
| Molecular Formula | C12H28N2OSi2 |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one |
| SMILES | CC1(C)[C@@H](N)C(=O)N1C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H28N2OSi2/c1-12(2)9(13)10(15)14(12)11(16(3,4)5)17(6,7)8/h9,11H,13H2,1-8H3/t9-/m0/s1 |
| InChIKey | VKQCTQQZNQTXFC-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one?
The IUPAC name of (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one (CID 90425260) is (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one.
What is the SMILES notation for (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one?
The canonical SMILES for (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one is CC1(C)[C@@H](N)C(=O)N1C([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one?
The InChIKey is VKQCTQQZNQTXFC-VIFPVBQESA-N. The full InChI is InChI=1S/C12H28N2OSi2/c1-12(2)9(13)10(15)14(12)11(16(3,4)5)17(6,7)8/h9,11H,13H2,1-8H3/t9-/m0/s1.
What are the key properties of (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one?
(3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one has a molecular weight of 272.54 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-1-[bis(trimethylsilyl)methyl]-4,4-dimethylazetidin-2-one is sourced from PubChem (CID 90425260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).