C7H9F3N4O — CID 90425593
[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl]methanol (PubChem CID 90425593) has the molecular formula C7H9F3N4O and a molecular weight of 222.17 g/mol. Its IUPAC name is [3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl]methanol.
| Compound Name | [3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl]methanol |
|---|---|
| PubChem CID | 90425593 |
| Molecular Formula | C7H9F3N4O |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | [3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl]methanol |
| SMILES | OCC1Cn2c(nnc2C(F)(F)F)CN1 |
| InChI | InChI=1S/C7H9F3N4O/c8-7(9,10)6-13-12-5-1-11-4(3-15)2-14(5)6/h4,11,15H,1-3H2 |
| InChIKey | ACESCWHXOYJWBK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |