C19H20F2IN3O — CID 90425617
4-[1-[dideuterio-(4,4-difluorocyclohexyl)methyl]-3-iodopyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 90425617) has the molecular formula C19H20F2IN3O and a molecular weight of 473.30 g/mol. Its IUPAC name is 4-[1-[dideuterio-(4,4-difluorocyclohexyl)methyl]-3-iodopyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-[dideuterio-(4,4-difluorocyclohexyl)methyl]-3-iodopyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 90425617 |
| Molecular Formula | C19H20F2IN3O |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 4-[1-[dideuterio-(4,4-difluorocyclohexyl)methyl]-3-iodopyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | [2H]C([2H])(C1CCC(F)(F)CC1)n1cc(I)c2ncc(-c3c(C)noc3C)cc21 |
| InChI | InChI=1S/C19H20F2IN3O/c1-11-17(12(2)26-24-11)14-7-16-18(23-8-14)15(22)10-25(16)9-13-3-5-19(20,21)6-4-13/h7-8,10,13H,3-6,9H2,1-2H3/i9D2 |
| InChIKey | HEUZLJQDJVWFBF-KNXIQCGSSA-N |
| XLogP | 5.74 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|